C15H28N2O5 — CID 46912343
(5S,6S,7S,8R)-6,7,8-trihydroxy-5-(octylamino)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 46912343) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is (5S,6S,7S,8R)-6,7,8-trihydroxy-5-(octylamino)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5S,6S,7S,8R)-6,7,8-trihydroxy-5-(octylamino)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 46912343 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (5S,6S,7S,8R)-6,7,8-trihydroxy-5-(octylamino)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CCCCCCCCN[C@@H]1[C@H](O)[C@@H](O)[C@H](O)C2COC(=O)N21 |
| InChI | InChI=1S/C15H28N2O5/c1-2-3-4-5-6-7-8-16-14-13(20)12(19)11(18)10-9-22-15(21)17(10)14/h10-14,16,18-20H,2-9H2,1H3/t10?,11-,12+,13-,14+/m1/s1 |
| InChIKey | VQLNHJXNPWFDCB-YUSLTOFOSA-N |
| XLogP | 0.18 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|