C15H27NO — CID 75163093
1-(5-methyl-2-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethanone (PubChem CID 75163093) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(5-methyl-2-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 1-(5-methyl-2-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 75163093 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-(5-methyl-2-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethanone |
| SMILES | CCCC1CCC2C(C)CCCC2N1C(C)=O |
| InChI | InChI=1S/C15H27NO/c1-4-6-13-9-10-14-11(2)7-5-8-15(14)16(13)12(3)17/h11,13-15H,4-10H2,1-3H3 |
| InChIKey | WQELMBZPIHHRRN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |