C16H31N — CID 91731891
1-methyl-2,5-dipropyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 91731891) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 1-methyl-2,5-dipropyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-methyl-2,5-dipropyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 91731891 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 1-methyl-2,5-dipropyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CCCC1CCCC2C1CCC(CCC)N2C |
| InChI | InChI=1S/C16H31N/c1-4-7-13-9-6-10-16-15(13)12-11-14(8-5-2)17(16)3/h13-16H,4-12H2,1-3H3 |
| InChIKey | LHVVNWLATYDCIT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |