C12H25NO2Si — CID 10705413
ethyl (2R,3R)-2-butyl-3-trimethylsilylaziridine-1-carboxylate (PubChem CID 10705413) has the molecular formula C12H25NO2Si and a molecular weight of 243.42 g/mol. Its IUPAC name is ethyl (2R,3R)-2-butyl-3-trimethylsilylaziridine-1-carboxylate.
| Compound Name | ethyl (2R,3R)-2-butyl-3-trimethylsilylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 10705413 |
| Molecular Formula | C12H25NO2Si |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | ethyl (2R,3R)-2-butyl-3-trimethylsilylaziridine-1-carboxylate |
| SMILES | CCCC[C@@H]1[C@@H]([Si](C)(C)C)N1C(=O)OCC |
| InChI | InChI=1S/C12H25NO2Si/c1-6-8-9-10-11(16(3,4)5)13(10)12(14)15-7-2/h10-11H,6-9H2,1-5H3/t10-,11-,13?/m1/s1 |
| InChIKey | FWWNFIWYJGZQCX-KKPNGEORSA-N |
| XLogP | 3.26 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|