C19H35NO2S2 — CID 71614430
ethyl (7R,9S)-9-methyl-7-octyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 71614430) has the molecular formula C19H35NO2S2 and a molecular weight of 373.63 g/mol. Its IUPAC name is ethyl (7R,9S)-9-methyl-7-octyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl (7R,9S)-9-methyl-7-octyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 71614430 |
| Molecular Formula | C19H35NO2S2 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | ethyl (7R,9S)-9-methyl-7-octyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CCCCCCCC[C@@H]1CC2(C[C@H](C)N1C(=O)OCC)SCCS2 |
| InChI | InChI=1S/C19H35NO2S2/c1-4-6-7-8-9-10-11-17-15-19(23-12-13-24-19)14-16(3)20(17)18(21)22-5-2/h16-17H,4-15H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | DQLLXFWSBBPSFS-DLBZAZTESA-N |
| XLogP | 5.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|