C18H35NO2 — CID 10902578
tert-butyl (2R,5R)-2-ethyl-5-heptylpyrrolidine-1-carboxylate (PubChem CID 10902578) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-ethyl-5-heptylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-2-ethyl-5-heptylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10902578 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | tert-butyl (2R,5R)-2-ethyl-5-heptylpyrrolidine-1-carboxylate |
| SMILES | CCCCCCC[C@@H]1CC[C@@H](CC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO2/c1-6-8-9-10-11-12-16-14-13-15(7-2)19(16)17(20)21-18(3,4)5/h15-16H,6-14H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | WBEVLVJRQYKIMB-HZPDHXFCSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|