C6H8ClNO4 — CID 10330243
dimethyl (2S,3S)-1-chloroaziridine-2,3-dicarboxylate (PubChem CID 10330243) has the molecular formula C6H8ClNO4 and a molecular weight of 193.59 g/mol. Its IUPAC name is dimethyl (2S,3S)-1-chloroaziridine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3S)-1-chloroaziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10330243 |
| Molecular Formula | C6H8ClNO4 |
| Molecular Weight | 193.59 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | dimethyl (2S,3S)-1-chloroaziridine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)N1Cl |
| InChI | InChI=1S/C6H8ClNO4/c1-11-5(9)3-4(8(3)7)6(10)12-2/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | GFOADQPZBBYZJI-IMJSIDKUSA-N |
| XLogP | -0.46 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.59 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|