C9H13NO3 — CID 11252383
methyl (3R)-2-acetyl-2-azabicyclo[2.1.1]hexane-3-carboxylate (PubChem CID 11252383) has the molecular formula C9H13NO3 and a molecular weight of 184.20 g/mol. Its IUPAC name is methyl (3R)-2-acetyl-2-azabicyclo[2.1.1]hexane-3-carboxylate.
| Compound Name | methyl (3R)-2-acetyl-2-azabicyclo[2.1.1]hexane-3-carboxylate |
|---|---|
| PubChem CID | 11252383 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | methyl (3R)-2-acetyl-2-azabicyclo[2.1.1]hexane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C2CC(C2)N1C([13CH3])=O |
| InChI | InChI=1S/C9H13NO3/c1-5(11)10-7-3-6(4-7)8(10)9(12)13-2/h6-8H,3-4H2,1-2H3/t6?,7?,8-/m1/s1/i1+1 |
| InChIKey | KHGKQWUPLMLNBI-IWNAQEJTSA-N |
| XLogP | 0.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |