C8H12FNO3 — CID 102153578
methyl (2R,3S)-1-acetyl-3-fluoropyrrolidine-2-carboxylate (PubChem CID 102153578) has the molecular formula C8H12FNO3 and a molecular weight of 189.19 g/mol. Its IUPAC name is methyl (2R,3S)-1-acetyl-3-fluoropyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3S)-1-acetyl-3-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102153578 |
| Molecular Formula | C8H12FNO3 |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | methyl (2R,3S)-1-acetyl-3-fluoropyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](F)CCN1C(C)=O |
| InChI | InChI=1S/C8H12FNO3/c1-5(11)10-4-3-6(9)7(10)8(12)13-2/h6-7H,3-4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | OAHZXWHPIVORON-BQBZGAKWSA-N |
| XLogP | 0.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |