C9H15NO4 — CID 54442436
methyl (3R)-1-acetyl-4-hydroxy-5-methylpyrrolidine-3-carboxylate (PubChem CID 54442436) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is methyl (3R)-1-acetyl-4-hydroxy-5-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-acetyl-4-hydroxy-5-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 54442436 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl (3R)-1-acetyl-4-hydroxy-5-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(C)=O)C(C)C1O |
| InChI | InChI=1S/C9H15NO4/c1-5-8(12)7(9(13)14-3)4-10(5)6(2)11/h5,7-8,12H,4H2,1-3H3/t5?,7-,8?/m1/s1 |
| InChIKey | WPBVMSRFRXFKHM-LXBRNSGXSA-N |
| XLogP | -0.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |