C15H25N3O4 — CID 73148466
methyl 1-acetyl-3-(cyclohexylcarbamoylamino)pyrrolidine-2-carboxylate (PubChem CID 73148466) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl 1-acetyl-3-(cyclohexylcarbamoylamino)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-acetyl-3-(cyclohexylcarbamoylamino)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 73148466 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | methyl 1-acetyl-3-(cyclohexylcarbamoylamino)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1C(NC(=O)NC2CCCCC2)CCN1C(C)=O |
| InChI | InChI=1S/C15H25N3O4/c1-10(19)18-9-8-12(13(18)14(20)22-2)17-15(21)16-11-6-4-3-5-7-11/h11-13H,3-9H2,1-2H3,(H2,16,17,21) |
| InChIKey | URIJQXDBGKWNCK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |