About methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate
methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 94824655) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate |
| PubChem CID | 94824655 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)N[C@H]2CCC[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C15H27N3O3/c1-11-4-3-5-13(10-11)17-14(19)16-12-6-8-18(9-7-12)15(20)21-2/h11-13H,3-10H2,1-2H3,(H2,16,17,19)/t11-,13+/m1/s1 |
| InChIKey | DMEUBOAMSINCFI-YPMHNXCESA-N |
| XLogP | 2.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate?
The IUPAC name of methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate (CID 94824655) is methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate?
The canonical SMILES for methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate is COC(=O)N1CCC(NC(=O)N[C@H]2CCC[C@@H](C)C2)CC1.
What is the InChIKey of methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate?
The InChIKey is DMEUBOAMSINCFI-YPMHNXCESA-N. The full InChI is InChI=1S/C15H27N3O3/c1-11-4-3-5-13(10-11)17-14(19)16-12-6-8-18(9-7-12)15(20)21-2/h11-13H,3-10H2,1-2H3,(H2,16,17,19)/t11-,13+/m1/s1.
What are the key properties of methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate?
methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate has a molecular weight of 297.40 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(1S,3R)-3-methylcyclohexyl]carbamoylamino]piperidine-1-carboxylate is sourced from PubChem (CID 94824655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).