C23H40N4O5 — CID 11865855
methyl 4-[[(2S,3S)-3-(cyclohexylcarbamoylamino)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 11865855) has the molecular formula C23H40N4O5 and a molecular weight of 452.60 g/mol. Its IUPAC name is methyl 4-[[(2S,3S)-3-(cyclohexylcarbamoylamino)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S,3S)-3-(cyclohexylcarbamoylamino)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11865855 |
| Molecular Formula | C23H40N4O5 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | methyl 4-[[(2S,3S)-3-(cyclohexylcarbamoylamino)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@@H]1[C@@H](NC(=O)NC2CCCCC2)CCN1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C23H40N4O5/c1-23(2,3)15-18(28)27-14-12-17(26-22(31)25-16-9-6-5-7-10-16)20(27)21(30)24-13-8-11-19(29)32-4/h16-17,20H,5-15H2,1-4H3,(H,24,30)(H2,25,26,31)/t17-,20-/m0/s1 |
| InChIKey | XDHQDLWTJXDFOP-PXNSSMCTSA-N |
| XLogP | 2.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|