C22H32N4O6 — CID 3678108
methyl 4-[[3-(cyclohexylcarbamoylamino)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 3678108) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl 4-[[3-(cyclohexylcarbamoylamino)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[3-(cyclohexylcarbamoylamino)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 3678108 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | methyl 4-[[3-(cyclohexylcarbamoylamino)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C1C(NC(=O)NC2CCCCC2)CCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C22H32N4O6/c1-31-18(27)10-5-12-23-20(28)19-16(25-22(30)24-15-7-3-2-4-8-15)11-13-26(19)21(29)17-9-6-14-32-17/h6,9,14-16,19H,2-5,7-8,10-13H2,1H3,(H,23,28)(H2,24,25,30) |
| InChIKey | SDMCQPVEQIXKRZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|