C20H29N5O5 — CID 3560734
methyl 4-[[1-(1-methylpyrrole-2-carbonyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 3560734) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl 4-[[1-(1-methylpyrrole-2-carbonyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[1-(1-methylpyrrole-2-carbonyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 3560734 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | methyl 4-[[1-(1-methylpyrrole-2-carbonyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | C=CCNC(=O)NC1CCN(C(=O)c2cccn2C)C1C(=O)NCCCC(=O)OC |
| InChI | InChI=1S/C20H29N5O5/c1-4-10-22-20(29)23-14-9-13-25(19(28)15-7-6-12-24(15)2)17(14)18(27)21-11-5-8-16(26)30-3/h4,6-7,12,14,17H,1,5,8-11,13H2,2-3H3,(H,21,27)(H2,22,23,29) |
| InChIKey | SODNCEXBAYFCDW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|