C12H16N2O3 — CID 101252038
methyl (2S)-1-(1-methylpyrrole-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 101252038) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl (2S)-1-(1-methylpyrrole-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(1-methylpyrrole-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101252038 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | methyl (2S)-1-(1-methylpyrrole-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)c1cccn1C |
| InChI | InChI=1S/C12H16N2O3/c1-13-7-3-5-9(13)11(15)14-8-4-6-10(14)12(16)17-2/h3,5,7,10H,4,6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | TUYUERLYKNCKPF-JTQLQIEISA-N |
| XLogP | 0.80 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |