C22H33N3O4 — CID 56528525
2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-butanoylpyrrolidine-2-carboxylate (PubChem CID 56528525) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-butanoylpyrrolidine-2-carboxylate.
| Compound Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-butanoylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56528525 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-butanoylpyrrolidine-2-carboxylate |
| SMILES | CCCC(=O)N1CCCC1C(=O)OCCC1CCCCN1C(=O)c1cccn1C |
| InChI | InChI=1S/C22H33N3O4/c1-3-8-20(26)25-15-7-11-19(25)22(28)29-16-12-17-9-4-5-14-24(17)21(27)18-10-6-13-23(18)2/h6,10,13,17,19H,3-5,7-9,11-12,14-16H2,1-2H3 |
| InChIKey | TVYGEWCUQYOOBI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |