C22H24N2O3S — CID 56528514
2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-benzothiophene-2-carboxylate (PubChem CID 56528514) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-benzothiophene-2-carboxylate.
| Compound Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 56528514 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 1-benzothiophene-2-carboxylate |
| SMILES | Cn1cccc1C(=O)N1CCCCC1CCOC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C22H24N2O3S/c1-23-12-6-9-18(23)21(25)24-13-5-4-8-17(24)11-14-27-22(26)20-15-16-7-2-3-10-19(16)28-20/h2-3,6-7,9-10,12,15,17H,4-5,8,11,13-14H2,1H3 |
| InChIKey | SKJPSRAESBZXOF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |