C23H26N4O4 — CID 56528601
2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 2-(1-oxophthalazin-2-yl)acetate (PubChem CID 56528601) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 2-(1-oxophthalazin-2-yl)acetate.
| Compound Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 2-(1-oxophthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 56528601 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 2-(1-oxophthalazin-2-yl)acetate |
| SMILES | Cn1cccc1C(=O)N1CCCCC1CCOC(=O)Cn1ncc2ccccc2c1=O |
| InChI | InChI=1S/C23H26N4O4/c1-25-12-6-10-20(25)23(30)26-13-5-4-8-18(26)11-14-31-21(28)16-27-22(29)19-9-3-2-7-17(19)15-24-27/h2-3,6-7,9-10,12,15,18H,4-5,8,11,13-14,16H2,1H3 |
| InChIKey | ATXAXXRRXSAKJZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |