C20H22Cl2N2O3 — CID 56528622
2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 3,5-dichlorobenzoate (PubChem CID 56528622) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 3,5-dichlorobenzoate.
| Compound Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 56528622 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[1-(1-methylpyrrole-2-carbonyl)piperidin-2-yl]ethyl 3,5-dichlorobenzoate |
| SMILES | Cn1cccc1C(=O)N1CCCCC1CCOC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-23-8-4-6-18(23)19(25)24-9-3-2-5-17(24)7-10-27-20(26)14-11-15(21)13-16(22)12-14/h4,6,8,11-13,17H,2-3,5,7,9-10H2,1H3 |
| InChIKey | OXSWLPGZKYFPAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |