C21H36N2O4 — CID 60622944
methyl 5-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]pentanoate (PubChem CID 60622944) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl 5-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]pentanoate.
| Compound Name | methyl 5-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 60622944 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | methyl 5-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)C1CCC(NC(=O)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H36N2O4/c1-27-20(25)9-5-6-14-22-21(26)17-10-12-18(13-11-17)23-19(24)15-16-7-3-2-4-8-16/h16-18H,2-15H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | YRAYARXIJJWHKI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|