C9H16N2O2 — CID 5256834
1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide (PubChem CID 5256834) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5256834 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1C(C)CCN1C(C)=O |
| InChI | InChI=1S/C9H16N2O2/c1-6-4-5-11(7(2)12)8(6)9(13)10-3/h6,8H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | NHCHTCLURHEBAY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |