About 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide
1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide (PubChem CID 5256834) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide |
| PubChem CID | 5256834 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1C(C)CCN1C(C)=O |
| InChI | InChI=1S/C9H16N2O2/c1-6-4-5-11(7(2)12)8(6)9(13)10-3/h6,8H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | NHCHTCLURHEBAY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide?
The IUPAC name of 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide (CID 5256834) is 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide.
What is the SMILES notation for 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide?
The canonical SMILES for 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide is CNC(=O)C1C(C)CCN1C(C)=O.
What is the InChIKey of 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide?
The InChIKey is NHCHTCLURHEBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-6-4-5-11(7(2)12)8(6)9(13)10-3/h6,8H,4-5H2,1-3H3,(H,10,13).
What are the key properties of 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide?
1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide has a molecular weight of 184.24 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N,3-dimethylpyrrolidine-2-carboxamide is sourced from PubChem (CID 5256834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).