C11H11Cl2NO2 — CID 54269267
methyl 1,3-dichloro-3,4-dihydro-2H-quinoline-2-carboxylate (PubChem CID 54269267) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is methyl 1,3-dichloro-3,4-dihydro-2H-quinoline-2-carboxylate.
| Compound Name | methyl 1,3-dichloro-3,4-dihydro-2H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 54269267 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | methyl 1,3-dichloro-3,4-dihydro-2H-quinoline-2-carboxylate |
| SMILES | COC(=O)C1C(Cl)Cc2ccccc2N1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c1-16-11(15)10-8(12)6-7-4-2-3-5-9(7)14(10)13/h2-5,8,10H,6H2,1H3 |
| InChIKey | RIZRNTPJVCSWGW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|