C8H7Cl2N — CID 88619979
1,2-dichloro-2,3-dihydroindole (PubChem CID 88619979) has the molecular formula C8H7Cl2N and a molecular weight of 188.06 g/mol. Its IUPAC name is 1,2-dichloro-2,3-dihydroindole.
| Compound Name | 1,2-dichloro-2,3-dihydroindole |
|---|---|
| PubChem CID | 88619979 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 1,2-dichloro-2,3-dihydroindole |
| SMILES | ClC1Cc2ccccc2N1Cl |
| InChI | InChI=1S/C8H7Cl2N/c9-8-5-6-3-1-2-4-7(6)11(8)10/h1-4,8H,5H2 |
| InChIKey | OPRSHKBYAUSZII-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|