C23H36N2O4 — CID 144898884
tert-butyl 2-(1-formylpiperidin-4-yl)pyrrolidine-1-carboxylate;methoxymethylbenzene (PubChem CID 144898884) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is tert-butyl 2-(1-formylpiperidin-4-yl)pyrrolidine-1-carboxylate;methoxymethylbenzene.
| Compound Name | tert-butyl 2-(1-formylpiperidin-4-yl)pyrrolidine-1-carboxylate;methoxymethylbenzene |
|---|---|
| PubChem CID | 144898884 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | tert-butyl 2-(1-formylpiperidin-4-yl)pyrrolidine-1-carboxylate;methoxymethylbenzene |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C1CCN(C=O)CC1.COCc1ccccc1 |
| InChI | InChI=1S/C15H26N2O3.C8H10O/c1-15(2,3)20-14(19)17-8-4-5-13(17)12-6-9-16(11-18)10-7-12;1-9-7-8-5-3-2-4-6-8/h11-13H,4-10H2,1-3H3;2-6H,7H2,1H3 |
| InChIKey | MYBOGMYQCIPXMT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|