C27H31NO4 — CID 69047628
tert-butyl 2-[[4-[furan-3-yl(phenyl)methyl]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 69047628) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl 2-[[4-[furan-3-yl(phenyl)methyl]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[furan-3-yl(phenyl)methyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69047628 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | tert-butyl 2-[[4-[furan-3-yl(phenyl)methyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1ccc(C(c2ccccc2)c2ccoc2)cc1 |
| InChI | InChI=1S/C27H31NO4/c1-27(2,3)32-26(29)28-16-7-10-23(28)19-31-24-13-11-21(12-14-24)25(22-15-17-30-18-22)20-8-5-4-6-9-20/h4-6,8-9,11-15,17-18,23,25H,7,10,16,19H2,1-3H3 |
| InChIKey | XZRGSAORUSFQLO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |