C16H23N3O6 — CID 156848354
tert-butyl (2R)-2-[(4-methoxy-3-nitro-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 156848354) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-methoxy-3-nitro-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(4-methoxy-3-nitro-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156848354 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | tert-butyl (2R)-2-[(4-methoxy-3-nitro-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccnc(OC[C@H]2CCCN2C(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O6/c1-16(2,3)25-15(20)18-9-5-6-11(18)10-24-14-13(19(21)22)12(23-4)7-8-17-14/h7-8,11H,5-6,9-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | LZLTYAABPTUCGZ-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|