C20H28N2O6 — CID 140929453
tert-butyl (2R)-2-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 140929453) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140929453 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl (2R)-2-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1COc1cc2c(cc1[N+](=O)[O-])CC(C)(C)O2 |
| InChI | InChI=1S/C20H28N2O6/c1-19(2,3)28-18(23)21-8-6-7-14(21)12-26-17-10-16-13(9-15(17)22(24)25)11-20(4,5)27-16/h9-10,14H,6-8,11-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | DHSCJOXVCIXDEO-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|