C22H30ClN5O5 — CID 160549892
tert-butyl (2S)-2-[(5-amino-6-methyl-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate;6-chloro-2-methyl-3-nitropyridine (PubChem CID 160549892) has the molecular formula C22H30ClN5O5 and a molecular weight of 479.97 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5-amino-6-methyl-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate;6-chloro-2-methyl-3-nitropyridine.
| Compound Name | tert-butyl (2S)-2-[(5-amino-6-methyl-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate;6-chloro-2-methyl-3-nitropyridine |
|---|---|
| PubChem CID | 160549892 |
| Molecular Formula | C22H30ClN5O5 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | tert-butyl (2S)-2-[(5-amino-6-methyl-2-pyridinyl)oxymethyl]pyrrolidine-1-carboxylate;6-chloro-2-methyl-3-nitropyridine |
| SMILES | Cc1nc(Cl)ccc1[N+](=O)[O-].Cc1nc(OC[C@@H]2CCCN2C(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C16H25N3O3.C6H5ClN2O2/c1-11-13(17)7-8-14(18-11)21-10-12-6-5-9-19(12)15(20)22-16(2,3)4;1-4-5(9(10)11)2-3-6(7)8-4/h7-8,12H,5-6,9-10,17H2,1-4H3;2-3H,1H3/t12-;/m0./s1 |
| InChIKey | QXXPDPGVDFFHEX-YDALLXLXSA-N |
| XLogP | 4.70 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|