C19H27N3O6 — CID 137368278
tert-butyl 3-amino-4-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylate (PubChem CID 137368278) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-4-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 137368278 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl 3-amino-4-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)C(Oc2cc3c(cc2[N+](=O)[O-])CC(C)(C)O3)C1 |
| InChI | InChI=1S/C19H27N3O6/c1-18(2,3)28-17(23)21-9-12(20)16(10-21)26-15-7-14-11(6-13(15)22(24)25)8-19(4,5)27-14/h6-7,12,16H,8-10,20H2,1-5H3 |
| InChIKey | NNBWAZZTNMCMQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|