C19H31NO3S — CID 71633719
tert-butyl 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine-1-carboxylate (PubChem CID 71633719) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is tert-butyl 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71633719 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine-1-carboxylate |
| SMILES | CC(OCCCC1CCCCN1C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C19H31NO3S/c1-15(17-11-8-14-24-17)22-13-7-10-16-9-5-6-12-20(16)18(21)23-19(2,3)4/h8,11,14-16H,5-7,9-10,12-13H2,1-4H3 |
| InChIKey | WHWNRWPRWNNUAS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|