C18H30N4O2 — CID 97175389
tert-butyl 4-[[methyl-[(1S)-1-pyrazin-2-ylethyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 97175389) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 4-[[methyl-[(1S)-1-pyrazin-2-ylethyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[methyl-[(1S)-1-pyrazin-2-ylethyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97175389 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | tert-butyl 4-[[methyl-[(1S)-1-pyrazin-2-ylethyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](c1cnccn1)N(C)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30N4O2/c1-14(16-12-19-8-9-20-16)21(5)13-15-6-10-22(11-7-15)17(23)24-18(2,3)4/h8-9,12,14-15H,6-7,10-11,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | VNDXLVLIIZJMEK-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |