C19H34IN5O3 — CID 109428492
tert-butyl 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 109428492) has the molecular formula C19H34IN5O3 and a molecular weight of 507.42 g/mol. Its IUPAC name is tert-butyl 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109428492 |
| Molecular Formula | C19H34IN5O3 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | tert-butyl 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCC1CCCCN1C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H33N5O3.HI/c1-13-14(2)26-16(23-13)12-22-17(20-6)21-11-15-9-7-8-10-24(15)18(25)27-19(3,4)5;/h15H,7-12H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | QECVIHAEQAAMLR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|