C23H37IN6S — CID 111535249
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide (PubChem CID 111535249) has the molecular formula C23H37IN6S and a molecular weight of 556.56 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111535249 |
| Molecular Formula | C23H37IN6S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCCCCN2CCN(c3cccc(C)c3)CC2)s1.I |
| InChI | InChI=1S/C23H36N6S.HI/c1-4-21-17-26-22(30-21)18-27-23(24-3)25-10-5-6-11-28-12-14-29(15-13-28)20-9-7-8-19(2)16-20;/h7-9,16-17H,4-6,10-15,18H2,1-3H3,(H2,24,25,27);1H |
| InChIKey | SGASQKVSDSLLCK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|