C23H38N8 — CID 111699887
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine (PubChem CID 111699887) has the molecular formula C23H38N8 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine |
|---|---|
| PubChem CID | 111699887 |
| Molecular Formula | C23H38N8 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCCCN1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C23H38N8/c1-4-22-28-27-19-31(22)13-11-26-23(24-3)25-10-5-6-12-29-14-16-30(17-15-29)21-9-7-8-20(2)18-21/h7-9,18-19H,4-6,10-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | GUAPTEOECLUGOV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|