C15H28IN5OS — CID 111523695
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111523695) has the molecular formula C15H28IN5OS and a molecular weight of 453.39 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523695 |
| Molecular Formula | C15H28IN5OS |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCN1CCOCC1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C15H27N5OS.HI/c1-13-11-18-14(22-13)12-19-15(16-2)17-5-3-4-6-20-7-9-21-10-8-20;/h11H,3-10,12H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | MLORGUKQXADORC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|