C18H32IN5OS — CID 111509902
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111509902) has the molecular formula C18H32IN5OS and a molecular weight of 493.46 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111509902 |
| Molecular Formula | C18H32IN5OS |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCC1(N2CCOCC2)CCCCC1.I |
| InChI | InChI=1S/C18H31N5OS.HI/c1-15-12-20-16(25-15)13-21-17(19-2)22-14-18(6-4-3-5-7-18)23-8-10-24-11-9-23;/h12H,3-11,13-14H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | FNNLCEORLLICKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|