C20H35N5OS — CID 111759829
1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111759829) has the molecular formula C20H35N5OS and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111759829 |
| Molecular Formula | C20H35N5OS |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1sc(C)nc1C)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H35N5OS/c1-16-18(27-17(2)24-16)7-10-22-19(21-3)23-15-20(8-5-4-6-9-20)25-11-13-26-14-12-25/h4-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | DOJWPZUYKDUHBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|