C18H28IN5S — CID 111534917
1-[[3-[(dimethylamino)methyl]phenyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111534917) has the molecular formula C18H28IN5S and a molecular weight of 473.43 g/mol. Its IUPAC name is 1-[[3-[(dimethylamino)methyl]phenyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-[(dimethylamino)methyl]phenyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111534917 |
| Molecular Formula | C18H28IN5S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 1-[[3-[(dimethylamino)methyl]phenyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2cccc(CN(C)C)c2)s1.I |
| InChI | InChI=1S/C18H27N5S.HI/c1-5-16-11-20-17(24-16)12-22-18(19-2)21-10-14-7-6-8-15(9-14)13-23(3)4;/h6-9,11H,5,10,12-13H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | WFLSSJNUFPVGAL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|