C19H29IN4OS — CID 111534347
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[3-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111534347) has the molecular formula C19H29IN4OS and a molecular weight of 488.44 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[3-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[3-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534347 |
| Molecular Formula | C19H29IN4OS |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[3-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2cccc(OCC(C)C)c2)s1.I |
| InChI | InChI=1S/C19H28N4OS.HI/c1-5-17-11-21-18(25-17)12-23-19(20-4)22-10-15-7-6-8-16(9-15)24-13-14(2)3;/h6-9,11,14H,5,10,12-13H2,1-4H3,(H2,20,22,23);1H |
| InChIKey | BKDIOUIIBOFPFL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|