C16H24N6S — CID 109403604
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine (PubChem CID 109403604) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109403604 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2cccc(N(C)C)n2)s1 |
| InChI | InChI=1S/C16H24N6S/c1-5-13-10-18-15(23-13)11-20-16(17-2)19-9-12-7-6-8-14(21-12)22(3)4/h6-8,10H,5,9,11H2,1-4H3,(H2,17,19,20) |
| InChIKey | JKSCBADKIBAIBY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|