C15H22IN5OS — CID 111534050
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111534050) has the molecular formula C15H22IN5OS and a molecular weight of 447.35 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111534050 |
| Molecular Formula | C15H22IN5OS |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2cccc(OC)n2)s1.I |
| InChI | InChI=1S/C15H21N5OS.HI/c1-4-12-9-17-14(22-12)10-19-15(16-2)18-8-11-6-5-7-13(20-11)21-3;/h5-7,9H,4,8,10H2,1-3H3,(H2,16,18,19);1H |
| InChIKey | PEIFCUMCWGZACN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|