C23H30ClN5O2 — CID 111680660
N-[3-[[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111680660) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is N-[3-[[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111680660 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[3-[[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)N2CCCC2)c1)NCC(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-17(31-21-10-8-19(24)9-11-21)15-26-22(25-2)27-16-18-6-5-7-20(14-18)28-23(30)29-12-3-4-13-29/h5-11,14,17H,3-4,12-13,15-16H2,1-2H3,(H,28,30)(H2,25,26,27) |
| InChIKey | ZVDNBNRREZLECN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|