C18H31N5O — CID 111159137
1-[4-[[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 111159137) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[4-[[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111159137 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 1-[4-[[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | CCCCN(C)/C(=N\C)NCc1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H31N5O/c1-6-7-12-23(5)17(19-4)20-13-15-8-10-16(11-9-15)22-18(24)21-14(2)3/h8-11,14H,6-7,12-13H2,1-5H3,(H,19,20)(H2,21,22,24) |
| InChIKey | DGTDKXFBTUDOHP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|