C18H20BrN5 — CID 110951956
1-benzyl-3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dimethylguanidine (PubChem CID 110951956) has the molecular formula C18H20BrN5 and a molecular weight of 386.30 g/mol. Its IUPAC name is 1-benzyl-3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-benzyl-3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 110951956 |
| Molecular Formula | C18H20BrN5 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1-benzyl-3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCc1cn2cc(Br)ccc2n1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H20BrN5/c1-20-18(23(2)11-14-6-4-3-5-7-14)21-10-16-13-24-12-15(19)8-9-17(24)22-16/h3-9,12-13H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | DNIWTXOPXNHRTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|