C14H27IN4S — CID 111160217
1-butyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111160217) has the molecular formula C14H27IN4S and a molecular weight of 410.37 g/mol. Its IUPAC name is 1-butyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111160217 |
| Molecular Formula | C14H27IN4S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-butyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCCc1csc(CC)n1.I |
| InChI | InChI=1S/C14H26N4S.HI/c1-5-7-10-18(4)14(15-3)16-9-8-12-11-19-13(6-2)17-12;/h11H,5-10H2,1-4H3,(H,15,16);1H |
| InChIKey | ZKVFBUNTGYROLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|