C16H23ClF3IN4 — CID 111293966
1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111293966) has the molecular formula C16H23ClF3IN4 and a molecular weight of 490.74 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111293966 |
| Molecular Formula | C16H23ClF3IN4 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C16H22ClF3N4.HI/c1-21-15(23(2)9-12-3-5-13(17)6-4-12)22-14-7-8-24(10-14)11-16(18,19)20;/h3-6,14H,7-11H2,1-2H3,(H,21,22);1H |
| InChIKey | QVPGOFSJFUYKIX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|