C17H26F3IN4 — CID 111287184
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111287184) has the molecular formula C17H26F3IN4 and a molecular weight of 470.32 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287184 |
| Molecular Formula | C17H26F3IN4 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCN(CC(F)(F)F)C1)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C17H25F3N4.HI/c1-13-6-4-5-7-14(13)10-23(3)16(21-2)22-15-8-9-24(11-15)12-17(18,19)20;/h4-7,15H,8-12H2,1-3H3,(H,21,22);1H |
| InChIKey | QFMCPIYZJJWDMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|