C17H27F3IN5O2S — CID 111913793
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111913793) has the molecular formula C17H27F3IN5O2S and a molecular weight of 549.40 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111913793 |
| Molecular Formula | C17H27F3IN5O2S |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)N(C)C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C17H26F3N5O2S.HI/c1-21-16(23-14-8-9-25(11-14)12-17(18,19)20)22-10-13-6-4-5-7-15(13)28(26,27)24(2)3;/h4-7,14H,8-12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | JTDBVTLVKQWBJI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|