C18H28F3IN4S — CID 111299254
2-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111299254) has the molecular formula C18H28F3IN4S and a molecular weight of 516.42 g/mol. Its IUPAC name is 2-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299254 |
| Molecular Formula | C18H28F3IN4S |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 2-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C18H27F3N4S.HI/c1-4-22-17(23-15-9-10-25(12-15)13-18(19,20)21)24(2)11-14-5-7-16(26-3)8-6-14;/h5-8,15H,4,9-13H2,1-3H3,(H,22,23);1H |
| InChIKey | AOTAJDZPKKNVTH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|